4-(2-Aminocyclopropyl)phenol
 10589 C9H11NO 149.19
 InChI=1S/C9H11NO/c10-9-5-8(9)6-1-3-7(11)4-2-6/h1-4,8-9,11H,5,10H2
 HADIWKXZWHXEDX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NC1CC1c1ccc(cc1)O