4-Chloronorephedrine
2-Amino-1-(4-chlorophenyl)propan-1-ol
 10588  C9H12ClNO  185.651
 InChI=1S/C9H12ClNO/c1-6(11)9(12)7-2-4-8(10)5-3-7/h2-6,9,12H,11H2,1H3
 LTOCGMHUCZEAMG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 OC(c1ccc(cc1)Cl)C(N)C