4-(2-Aminopropyl)-N-methylaniline
 10581  C10H16N2  164.247
 InChI=1S/C10H16N2/c1-8(11)7-9-3-5-10(12-2)6-4-9/h3-6,8,12H,7,11H2,1-2H3
 WWJSIPHDEYGUGK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNc1ccc(cc1)CC(N)C