N-[1-(4-Iodophenyl)propan-2-yl]-3-phenylpropan-1-amine
 10578  C18H22IN  379.278
 InChI=1S/C18H22IN/c1-15(14-17-9-11-18(19)12-10-17)20-13-5-8-16-6-3-2-4-7-16/h2-4,6-7,9-12,15,20H,5,8,13-14H2,1H3
 NVVHZMXNPUHEAQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc(cc1)I)NCCCc1ccccc1