N-[2-(4-Chlorophenyl)ethyl]acetamide
 10569  C10H12ClNO  197.661
 InChI=1S/C10H12ClNO/c1-8(13)12-7-6-9-2-4-10(11)5-3-9/h2-5H,6-7H2,1H3,(H,12,13)
 WUALHNRHDHIVKF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(=O)NCCc1ccc(cc1)Cl