p-F-Deprenyl
N-[1-(4-Fluorophenyl)propan-2-yl]-N-methylprop-2-yn-1-amine
 10564  C13H16FN  205.271
 InChI=1S/C13H16FN/c1-4-9-15(3)11(2)10-12-5-7-13(14)8-6-12/h1,5-8,11H,9-10H2,2-3H3
 MUDUXRHPVDVWHU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(N(CC#C)C)Cc1ccc(cc1)F