1-[4-(Trimethylsilyl)phenyl]propan-2-amine
 10562  C12H21NSi  207.387
 InChI=1S/C12H21NSi/c1-10(13)9-11-5-7-12(8-6-11)14(2,3)4/h5-8,10H,9,13H2,1-4H3
 RBJAGBGAQNIFBH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc(cc1)[Si](C)(C)C)N