N,N-Dimethyl-2-[4-(trimethylsilyl)phenyl]ethan-1-amine
 10561  C13H23NSi  221.414
 InChI=1S/C13H23NSi/c1-14(2)11-10-12-6-8-13(9-7-12)15(3,4)5/h6-9H,10-11H2,1-5H3
 GFMIVLRIQDIUPY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCc1ccc(cc1)[Si](C)(C)C)C