{1-[4-(Propan-2-yl)phenyl]propan-2-yl}hydrazine
 10556  C12H20N2  192.301
 InChI=1S/C12H20N2/c1-9(2)12-6-4-11(5-7-12)8-10(3)14-13/h4-7,9-10,14H,8,13H2,1-3H3
 PVNRNJYIJJGSRB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NNC(Cc1ccc(cc1)C(C)C)C