ALLMA
1-{4-[(Prop-2-en-1-yl)oxy]phenyl}propan-2-amine
 10553 C12H17NO 191.269
 InChI=1S/C12H17NO/c1-3-8-14-12-6-4-11(5-7-12)9-10(2)13/h3-7,10H,1,8-9,13H2,2H3
 OOFWJNHILKXEIJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C=CCOc1ccc(cc1)CC(N)C