[1-(4-Methoxyphenyl)propan-2-yl]hydrazine
 10550  C10H16N2O  180.247
 InChI=1S/C10H16N2O/c1-8(12-11)7-9-3-5-10(13-2)6-4-9/h3-6,8,12H,7,11H2,1-2H3
 VIGQYLPJWCMABB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NNC(Cc1ccc(cc1)OC)C