2-Amino-3-(4-hydroxyphenyl)propanenitrile
 10547  C9H10N2O  162.189
 InChI=1S/C9H10N2O/c10-6-8(11)5-7-1-3-9(12)4-2-7/h1-4,8,12H,5,11H2
 VRAUBEZVWJCOIH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NC(Cc1ccc(cc1)O)C#N