2-[2-(Methylamino)propyl]aniline
 10480  C10H16N2  164.247
 InChI=1S/C10H16N2/c1-8(12-2)7-9-5-3-4-6-10(9)11/h3-6,8,12H,7,11H2,1-2H3
 SHRPXUBCCDCQAI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(Cc1ccccc1N)C