5-(2-Aminoethyl)-3,6-dimethylbenzene-1,2,4-triol
 10456 C10H15NO3 197.231
 InChI=1S/C10H15NO3/c1-5-7(3-4-11)8(12)6(2)10(14)9(5)13/h12-14H,3-4,11H2,1-2H3
 XVCHFWOASRHNAW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(O)c(C)c(c(c1C)O)O