N,N-Dimethyl-2-(2,4,5-trimethoxy-3,6-dimethylphenyl)ethan-1-amine
 10454 C15H25NO3 267.364
 InChI=1S/C15H25NO3/c1-10-12(8-9-16(3)4)13(17-5)11(2)15(19-7)14(10)18-6/h8-9H2,1-7H3
 XQCABTSTVZIBMW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1c(CCN(C)C)c(C)c(c(c1C)OC)OC