1-(2,3,5,6-Tetrafluorophenyl)propan-2-amine
 10437  C9H9F4N  207.168
 InChI=1S/C9H9F4N/c1-4(14)2-5-8(12)6(10)3-7(11)9(5)13/h3-4H,2,14H2,1H3
 SQVBTODMDVRLDB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1c(F)c(F)cc(c1F)F)N