2-(2-Aminoethyl)-3,4,6-trichlorophenol
 10436  C8H8Cl3NO  240.514
 InChI=1S/C8H8Cl3NO/c9-5-3-6(10)8(13)4(1-2-12)7(5)11/h3,13H,1-2,12H2
 UKOUFWJRRLHXGH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(O)c(Cl)cc(c1Cl)Cl