5-(2-Aminoethyl)-6-methylbenzene-1,2,4-triol
 10424  C9H13NO3  183.204
 InChI=1S/C9H13NO3/c1-5-6(2-3-10)7(11)4-8(12)9(5)13/h4,11-13H,2-3,10H2,1H3
 WWYQEGUUFKELML-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(O)cc(c(c1C)O)O