4-(2-Aminoethyl)-3,5-difluorobenzene-1,2-diol
 10421  C8H9F2NO2  189.159
 InChI=1S/C8H9F2NO2/c9-5-3-6(12)8(13)7(10)4(5)1-2-11/h3,12-13H,1-2,11H2
 POHULUVQXHPDSG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(F)cc(c(c1F)O)O