4-Methoxy-2,3,5-trimethylamphetamine
1-(4-Methoxy-2,3,5-trimethylphenyl)propan-2-amine
 10412  C13H21NO  207.312
 InChI=1S/C13H21NO/c1-8-6-12(7-9(2)14)10(3)11(4)13(8)15-5/h6,9H,7,14H2,1-5H3
 QNRBAINXCRGPAS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1c(C)cc(c(c1C)C)CC(N)C