5-(2-Aminoethyl)benzene-1,2,3,4-tetrol
 10409  C8H11NO4  185.177
 InChI=1S/C8H11NO4/c9-2-1-4-3-5(10)7(12)8(13)6(4)11/h3,10-13H,1-2,9H2
 SXZFCJURIWPUCO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(O)c(c(c1O)O)O