5-(2-Aminoethyl)-3-methylbenzene-1,2,4-triol
 10407  C9H13NO3  183.204
 InChI=1S/C9H13NO3/c1-5-8(12)6(2-3-10)4-7(11)9(5)13/h4,11-13H,2-3,10H2,1H3
 VFBWQQWVDKMENN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(O)c(c(c1O)C)O