2-(2,3,4,5-Tetrafluorophenyl)ethan-1-amine
 10403  C8H7F4N  193.141
 InChI=1S/C8H7F4N/c9-5-3-4(1-2-13)6(10)8(12)7(5)11/h3H,1-2,13H2
 HKNCGYWBMZJMNX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(F)c(c(c1F)F)F