2-(5-Fluoro-3,4-dimethoxy-2-propylphenyl)ethan-1-amine
 10402  C13H20FNO2  241.302
 InChI=1S/C13H20FNO2/c1-4-5-10-9(6-7-15)8-11(14)13(17-3)12(10)16-2/h8H,4-7,15H2,1-3H3
 AYPSLTJQUMDAFC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCc1c(CCN)cc(c(c1OC)OC)F