2-(2,5-Difluoro-3,4-dimethoxyphenyl)ethan-1-amine
 10399  C10H13F2NO2  217.213
 InChI=1S/C10H13F2NO2/c1-14-9-7(11)5-6(3-4-13)8(12)10(9)15-2/h5H,3-4,13H2,1-2H3
 YDAFXWGQTGLFOY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(F)c(c(c1F)OC)OC