4-(2-Aminoethyl)-2,3-bis(benzylsulfanyl)-6-methoxyphenol
 10396  C23H25NO2S2  411.58
 InChI=1S/C23H25NO2S2/c1-26-20-14-19(12-13-24)22(27-15-17-8-4-2-5-9-17)23(21(20)25)28-16-18-10-6-3-7-11-18/h2-11,14,25H,12-13,15-16,24H2,1H3
 ZXUQKRPWEOIVCN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1SCc1ccccc1)SCc1ccccc1)O