4-(2-Aminoethyl)-2,3-bis(butylsulfanyl)-6-methoxyphenol
 10394  C17H29NO2S2  343.548
 InChI=1S/C17H29NO2S2/c1-4-6-10-21-16-13(8-9-18)12-14(20-3)15(19)17(16)22-11-7-5-2/h12,19H,4-11,18H2,1-3H3
 FZMPCHGIUQGRFP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCSc1c(SCCCC)c(CCN)cc(c1O)OC