2-[2,3-Bis(butylsulfanyl)-4,5-dimethoxyphenyl]ethan-1-amine
 10393  C18H31NO2S2  357.574
 InChI=1S/C18H31NO2S2/c1-5-7-11-22-17-14(9-10-19)13-15(20-3)16(21-4)18(17)23-12-8-6-2/h13H,5-12,19H2,1-4H3
 LNGZVHGNUMDBIT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCSc1c(SCCCC)c(CCN)cc(c1OC)OC