2F-M
2-(2-Fluoro-3,4,5-trimethoxyphenyl)ethan-1-amine
 10383 C11H16FNO3 229.248
 InChI=1S/C11H16FNO3/c1-14-8-6-7(4-5-13)9(12)11(16-3)10(8)15-2/h6H,4-5,13H2,1-3H3
 JPLQXQAVVBGQOJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1F)OC)OC