1-(5,8-Dimethoxy-3,4-dihydro-1H-2-benzopyran-7-yl)propan-2-amine
 10378 C14H21NO3 251.321
 InChI=1S/C14H21NO3/c1-9(15)6-10-7-13(16-2)11-4-5-18-8-12(11)14(10)17-3/h7,9H,4-6,8,15H2,1-3H3
 QCVOMVKLYPJDGX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CC(N)C)c(c2c1CCOC2)OC