2,2′-(2,5-Dimethoxy-1,4-phenylene)di(ethan-1-amine)
 10372  C12H20N2O2  224.299
 InChI=1S/C12H20N2O2/c1-15-11-7-10(4-6-14)12(16-2)8-9(11)3-5-13/h7-8H,3-6,13-14H2,1-2H3
 PCKYRXKMRVNARB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1OC)CCN