DOB-AT
6-Bromo-5,8-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-amine
 10363  C12H16BrNO2  286.165
 InChI=1S/C12H16BrNO2/c1-15-11-6-10(13)12(16-2)8-4-3-7(14)5-9(8)11/h6-7H,3-5,14H2,1-2H3
 MLEMJOJVTOVSSR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(Br)c(c2c1CC(N)CC2)OC