2C-B-EtOH
2-{[2-(4-Bromo-2,5-dimethoxyphenyl)ethyl]amino}ethan-1-ol
 10357 C12H18BrNO3 304.18
 InChI=1S/C12H18BrNO3/c1-16-11-8-10(13)12(17-2)7-9(11)3-4-14-5-6-15/h7-8,14-15H,3-6H2,1-2H3
 CCGDNIITVLYRHK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(Br)c(cc1CCNCCO)OC