2C-DMeA
4-(2-Aminoethyl)-2,5-dimethoxy-N,N-dimethylaniline
 10349  C12H20N2O2  224.299
 InChI=1S/C12H20N2O2/c1-14(2)10-8-11(15-3)9(5-6-13)7-12(10)16-4/h7-8H,5-6,13H2,1-4H3
 KPWNHCXVLHFLGM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1OC)N(C)C