DOTFMO
1-[2,5-Dimethoxy-4-(trifluoromethoxy)phenyl]propan-2-amine
 10338 C12H16F3NO3 279.256
 InChI=1S/C12H16F3NO3/c1-7(16)4-8-5-10(18-3)11(6-9(8)17-2)19-12(13,14)15/h5-7H,4,16H2,1-3H3
 JGTUIPGZUVGSAH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(OC(F)(F)F)c(cc1CC(N)C)OC