DODFMO
1-[4-(Difluoromethoxy)-2,5-dimethoxyphenyl]propan-2-amine
 10337 C12H17F2NO3 261.265
 InChI=1S/C12H17F2NO3/c1-7(15)4-8-5-10(17-3)11(18-12(13)14)6-9(8)16-2/h5-7,12H,4,15H2,1-3H3
 SVLLINOXWIBNKX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(OC(F)F)c(cc1CC(N)C)OC