MALM
1-{2,5-Dimethoxy-4-[(prop-2-en-1-yl)oxy]phenyl}propan-2-amine
 10334 C14H21NO3 251.321
 InChI=1S/C14H21NO3/c1-5-6-18-14-9-12(16-3)11(7-10(2)15)8-13(14)17-4/h5,8-10H,1,6-7,15H2,2-4H3
 VBAQDLWNBQBWPR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C=CCOc1cc(OC)c(cc1OC)CC(N)C