1-Chloro-1-phenylpropan-2-amine
 10331  C9H12ClN  169.651
 InChI=1S/C9H12ClN/c1-7(11)9(10)8-5-3-2-4-6-8/h2-7,9H,11H2,1H3
 JYMAASGIKPNKOV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 ClC(c1ccccc1)C(N)C