N-(Phenethyl)heptan-3-ylamine
N-(2-Phenylethyl)heptan-3-amine
 10327  C15H25N  219.366
 InChI=1S/C15H25N/c1-3-5-11-15(4-2)16-13-12-14-9-7-6-8-10-14/h6-10,15-16H,3-5,11-13H2,1-2H3
 CTHFIPPPDYQPAQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCC(NCCc1ccccc1)CC