2C-2MVE
2-{2,5-Dimethoxy-4-[(1E)-prop-1-en-1-yl]phenyl}ethan-1-amine
 10313 C13H19NO2 221.295
 InChI=1S/C13H19NO2/c1-4-5-10-8-13(16-3)11(6-7-14)9-12(10)15-2/h4-5,8-9H,6-7,14H2,1-3H3/b5-4+
 VAAIKSIVRGHOTL-SNAWJCMRSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1OC)/C=C/C