2C-AL
2-[2,5-Dimethoxy-4-(prop-2-en-1-yl)phenyl]ethan-1-amine
 10311 C13H19NO2 221.295
 Prophetic?
 InChI=1S/C13H19NO2/c1-4-5-10-8-13(16-3)11(6-7-14)9-12(10)15-2/h4,8-9H,1,5-7,14H2,2-3H3
 QNVPDGCJKPQARD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1OC)CC=C