2C-CP
2-(4-Cyclopropyl-2,5-dimethoxyphenyl)ethan-1-amine
 10308 C13H19NO2 221.295
 Prophetic?
 InChI=1S/C13H19NO2/c1-15-12-8-11(9-3-4-9)13(16-2)7-10(12)5-6-14/h7-9H,3-6,14H2,1-2H3
 WSMVNFNZKKZCPU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1OC)C1CC1