2-(4,5,6-Trimethoxypyrimidin-2-yl)ethan-1-amine
 10306 C9H15N3O3 213.234
 InChI=1S/C9H15N3O3/c1-13-7-8(14-2)11-6(4-5-10)12-9(7)15-3/h4-5,10H2,1-3H3
 YMJZLPZQHOOSNQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1nc(OC)c(c(n1)OC)OC