2-(4,5,6-Trimethoxypyridin-2-yl)ethan-1-amine
 10305 C10H16N2O3 212.246
 InChI=1S/C10H16N2O3/c1-13-8-6-7(4-5-11)12-10(15-3)9(8)14-2/h6H,4-5,11H2,1-3H3
 LASYEUDXGOYIRV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(n1)OC)OC