DMAL
2-[3,5-Dimethoxy-4-(2-methylprop-2-en-1-yl)phenyl]ethan-1-amine
 10304 C14H21NO2 235.322
 InChI=1S/C14H21NO2/c1-10(2)7-12-13(16-3)8-11(5-6-15)9-14(12)17-4/h8-9H,1,5-7,15H2,2-4H3
 NVYXDWPUNLBFRJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1)OC)CC(=C)C