DIP
2-[3,5-Dimethoxy-4-(propan-2-yl)phenyl]ethan-1-amine
 10303 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-9(2)13-11(15-3)7-10(5-6-14)8-12(13)16-4/h7-9H,5-6,14H2,1-4H3
 XIPZDDBTVZEDMM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1)OC)C(C)C