DAL
2-[3,5-Dimethoxy-4-(prop-2-en-1-yl)phenyl]ethan-1-amine
 10302 C13H19NO2 221.295
 InChI=1S/C13H19NO2/c1-4-5-11-12(15-2)8-10(6-7-14)9-13(11)16-3/h4,8-9H,1,5-7,14H2,2-3H3
 LKFDAZPERRIXPF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1)OC)CC=C