DPR
2-(3,5-Dimethoxy-4-propylphenyl)ethan-1-amine
 10301 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-4-5-11-12(15-2)8-10(6-7-14)9-13(11)16-3/h8-9H,4-7,14H2,1-3H3
 BTBPZTGEBQCKNF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCc1c(OC)cc(cc1OC)CCN