DTFE
2-[3,5-Dimethoxy-4-(2,2,2-trifluoroethyl)phenyl]ethan-1-amine
 10300 C12H16F3NO2 263.256
 InChI=1S/C12H16F3NO2/c1-17-10-5-8(3-4-16)6-11(18-2)9(10)7-12(13,14)15/h5-6H,3-4,7,16H2,1-2H3
 ZDMXJTBAWPGEKX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1)OC)CC(F)(F)F