DYN
2-(4-Ethynyl-3,5-dimethoxyphenyl)ethan-1-amine
 10298 C12H15NO2 205.253
 InChI=1S/C12H15NO2/c1-4-10-11(14-2)7-9(5-6-13)8-12(10)15-3/h1,7-8H,5-6,13H2,2-3H3
 MFPZKMLFSKYTDO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1)OC)C#C